C10H7F3N2O2 — CID 134685934
ethyl 6-cyano-5-(difluoromethyl)-3-fluoropyridine-2-carboxylate (PubChem CID 134685934) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is ethyl 6-cyano-5-(difluoromethyl)-3-fluoropyridine-2-carboxylate.
| Compound Name | ethyl 6-cyano-5-(difluoromethyl)-3-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 134685934 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | ethyl 6-cyano-5-(difluoromethyl)-3-fluoropyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C#N)c(C(F)F)cc1F |
| InChI | InChI=1S/C10H7F3N2O2/c1-2-17-10(16)8-6(11)3-5(9(12)13)7(4-14)15-8/h3,9H,2H2,1H3 |
| InChIKey | YVDNLGVKKXIZLP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |