C23H30N2O6 — CID 134686711
N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pentane-1,5-diamine (PubChem CID 134686711) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pentane-1,5-diamine.
| Compound Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 134686711 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N,N'-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pentane-1,5-diamine |
| SMILES | COc1cc(CNCCCCCNCc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
| InChI | InChI=1S/C23H30N2O6/c1-26-18-8-16(10-20-22(18)30-14-28-20)12-24-6-4-3-5-7-25-13-17-9-19(27-2)23-21(11-17)29-15-31-23/h8-11,24-25H,3-7,12-15H2,1-2H3 |
| InChIKey | BJMZLJGPDOOYON-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|