C15H28O — CID 134686937
[(1S,2S,3R)-2-butyl-3-[(E)-hex-1-enyl]-2-methylcyclopropyl]methanol (PubChem CID 134686937) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is [(1S,2S,3R)-2-butyl-3-[(E)-hex-1-enyl]-2-methylcyclopropyl]methanol.
| Compound Name | [(1S,2S,3R)-2-butyl-3-[(E)-hex-1-enyl]-2-methylcyclopropyl]methanol |
|---|---|
| PubChem CID | 134686937 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | [(1S,2S,3R)-2-butyl-3-[(E)-hex-1-enyl]-2-methylcyclopropyl]methanol |
| SMILES | CCCC/C=C/[C@@H]1[C@H](CO)[C@@]1(C)CCCC |
| InChI | InChI=1S/C15H28O/c1-4-6-8-9-10-13-14(12-16)15(13,3)11-7-5-2/h9-10,13-14,16H,4-8,11-12H2,1-3H3/b10-9+/t13-,14+,15+/m1/s1 |
| InChIKey | SDQVRNNQEOOCAU-QQCCPQOUSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|