C14H25ClO — CID 134686941
[(1S,2S,3R)-2-butyl-3-[(E)-5-chloropent-1-enyl]-2-methylcyclopropyl]methanol (PubChem CID 134686941) has the molecular formula C14H25ClO and a molecular weight of 244.81 g/mol. Its IUPAC name is [(1S,2S,3R)-2-butyl-3-[(E)-5-chloropent-1-enyl]-2-methylcyclopropyl]methanol.
| Compound Name | [(1S,2S,3R)-2-butyl-3-[(E)-5-chloropent-1-enyl]-2-methylcyclopropyl]methanol |
|---|---|
| PubChem CID | 134686941 |
| Molecular Formula | C14H25ClO |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [(1S,2S,3R)-2-butyl-3-[(E)-5-chloropent-1-enyl]-2-methylcyclopropyl]methanol |
| SMILES | CCCC[C@@]1(C)[C@H](/C=C/CCCCl)[C@@H]1CO |
| InChI | InChI=1S/C14H25ClO/c1-3-4-9-14(2)12(13(14)11-16)8-6-5-7-10-15/h6,8,12-13,16H,3-5,7,9-11H2,1-2H3/b8-6+/t12-,13+,14+/m1/s1 |
| InChIKey | VJUBEZPTFUQJAU-PMDFWAKSSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|