About 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide
2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide (PubChem CID 134687118) has the molecular formula C19H21ClF3NO2
and a molecular weight of 387.83 g/mol. Its IUPAC name is 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide |
| PubChem CID | 134687118 |
| Molecular Formula | C19H21ClF3NO2 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide |
| SMILES | COc1ccc(Cl)c(C(=O)NCC23CC4(F)CC(F)(CC(F)(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H21ClF3NO2/c1-26-12-2-3-14(20)13(4-12)15(25)24-11-16-5-17(21)8-18(22,6-16)10-19(23,7-16)9-17/h2-4H,5-11H2,1H3,(H,24,25) |
| InChIKey | DWSQAAMUNCFYTG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide?
The IUPAC name of 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide (CID 134687118) is 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide.
What is the SMILES notation for 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide?
The canonical SMILES for 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide is COc1ccc(Cl)c(C(=O)NCC23CC4(F)CC(F)(CC(F)(C4)C2)C3)c1.
What is the InChIKey of 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide?
The InChIKey is DWSQAAMUNCFYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClF3NO2/c1-26-12-2-3-14(20)13(4-12)15(25)24-11-16-5-17(21)8-18(22,6-16)10-19(23,7-16)9-17/h2-4H,5-11H2,1H3,(H,24,25).
What are the key properties of 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide?
2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide has a molecular weight of 387.83 g/mol, XLogP of 4.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide is sourced from PubChem (CID 134687118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).