C8H12N4O3 — CID 134687411
(4S,5S)-1,3,7-trimethyl-5,9-dihydro-4H-purine-2,6,8-trione (PubChem CID 134687411) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is (4S,5S)-1,3,7-trimethyl-5,9-dihydro-4H-purine-2,6,8-trione.
| Compound Name | (4S,5S)-1,3,7-trimethyl-5,9-dihydro-4H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 134687411 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (4S,5S)-1,3,7-trimethyl-5,9-dihydro-4H-purine-2,6,8-trione |
| SMILES | CN1C(=O)[C@@H]2[C@@H](NC(=O)N2C)N(C)C1=O |
| InChI | InChI=1S/C8H12N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h4-5H,1-3H3,(H,9,14)/t4-,5-/m0/s1 |
| InChIKey | OJKUXNTWKKZZAH-WHFBIAKZSA-N |
| XLogP | -1.14 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |