C16H24N4O4S — CID 134689329
[(1R,5R,7R)-3-(3-methylbutyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 134689329) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is [(1R,5R,7R)-3-(3-methylbutyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [(1R,5R,7R)-3-(3-methylbutyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 134689329 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(1R,5R,7R)-3-(3-methylbutyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CC(C)CCN1C[C@]23CN(C(=O)c4ccn[nH]4)C[C@@H](C[C@H]2S1(=O)=O)O3 |
| InChI | InChI=1S/C16H24N4O4S/c1-11(2)4-6-20-10-16-9-19(15(21)13-3-5-17-18-13)8-12(24-16)7-14(16)25(20,22)23/h3,5,11-12,14H,4,6-10H2,1-2H3,(H,17,18)/t12-,14-,16-/m1/s1 |
| InChIKey | NRWMIUVHAFDYCS-XNRPHZJLSA-N |
| XLogP | 0.45 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |