C17H28N4O — CID 134689340
1-methyl-5-(oxolan-3-ylmethyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 134689340) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-methyl-5-(oxolan-3-ylmethyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | 1-methyl-5-(oxolan-3-ylmethyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 134689340 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 1-methyl-5-(oxolan-3-ylmethyl)-2-(pyrazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1C(Cn2cccn2)CC2CN(CC3CCOC3)CCC21 |
| InChI | InChI=1S/C17H28N4O/c1-19-16(12-21-6-2-5-18-21)9-15-11-20(7-3-17(15)19)10-14-4-8-22-13-14/h2,5-6,14-17H,3-4,7-13H2,1H3 |
| InChIKey | JWYZMEYHCYIERO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |