C14H19FN4O2 — CID 134689425
(3aS,7aR)-5-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide (PubChem CID 134689425) has the molecular formula C14H19FN4O2 and a molecular weight of 294.33 g/mol. Its IUPAC name is (3aS,7aR)-5-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide.
| Compound Name | (3aS,7aR)-5-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
|---|---|
| PubChem CID | 134689425 |
| Molecular Formula | C14H19FN4O2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3aS,7aR)-5-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
| SMILES | CN(C)C(=O)[C@]12CCO[C@@H]1CCN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C14H19FN4O2/c1-18(2)12(20)14-4-6-21-11(14)3-5-19(9-14)13-16-7-10(15)8-17-13/h7-8,11H,3-6,9H2,1-2H3/t11-,14+/m1/s1 |
| InChIKey | VPBMPTAEKXUQRN-RISCZKNCSA-N |
| XLogP | 0.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |