C16H28N4S — CID 134689560
N,N-dimethyl-1-[(2S)-5-propyl-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine (PubChem CID 134689560) has the molecular formula C16H28N4S and a molecular weight of 308.49 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2S)-5-propyl-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(2S)-5-propyl-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine |
|---|---|
| PubChem CID | 134689560 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N,N-dimethyl-1-[(2S)-5-propyl-1-(1,3-thiazol-2-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-2-yl]methanamine |
| SMILES | CCCN1CCC2C(C[C@@H](CN(C)C)N2c2nccs2)C1 |
| InChI | InChI=1S/C16H28N4S/c1-4-7-19-8-5-15-13(11-19)10-14(12-18(2)3)20(15)16-17-6-9-21-16/h6,9,13-15H,4-5,7-8,10-12H2,1-3H3/t13?,14-,15?/m0/s1 |
| InChIKey | ZXYXDPSFCBJEQV-SLTAFYQDSA-N |
| XLogP | 2.38 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |