About 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone
1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone (PubChem CID 134689580) has the molecular formula C23H14FN3O3
and a molecular weight of 399.38 g/mol. Its IUPAC name is 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone.
Molecular Properties
| Compound Name | 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone |
| PubChem CID | 134689580 |
| Molecular Formula | C23H14FN3O3 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone |
| SMILES | O=C(Cc1ccccn1)c1ccc2onc(-c3coc(-c4ccc(F)cc4)n3)c2c1 |
| InChI | InChI=1S/C23H14FN3O3/c24-16-7-4-14(5-8-16)23-26-19(13-29-23)22-18-11-15(6-9-21(18)30-27-22)20(28)12-17-3-1-2-10-25-17/h1-11,13H,12H2 |
| InChIKey | WMBTWMKGLJKDCA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone?
The IUPAC name of 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone (CID 134689580) is 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone.
What is the SMILES notation for 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone?
The canonical SMILES for 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone is O=C(Cc1ccccn1)c1ccc2onc(-c3coc(-c4ccc(F)cc4)n3)c2c1.
What is the InChIKey of 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone?
The InChIKey is WMBTWMKGLJKDCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14FN3O3/c24-16-7-4-14(5-8-16)23-26-19(13-29-23)22-18-11-15(6-9-21(18)30-27-22)20(28)12-17-3-1-2-10-25-17/h1-11,13H,12H2.
What are the key properties of 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone?
1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone has a molecular weight of 399.38 g/mol, XLogP of 5.11, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1,2-benzoxazol-5-yl]-2-pyridin-2-ylethanone is sourced from PubChem (CID 134689580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).