C11H19NO9 — CID 134689626
(2R,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 134689626) has the molecular formula C11H19NO9 and a molecular weight of 309.27 g/mol. Its IUPAC name is (2R,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 134689626 |
| Molecular Formula | C11H19NO9 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2R,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)C(O)CO)O[C@@](O)(C(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C11H19NO9/c1-4(14)12-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-13/h5-9,13,15-17,20H,2-3H2,1H3,(H,12,14)(H,18,19)/t5-,6?,7+,8+,9+,11+/m0/s1 |
| InChIKey | SQVRNKJHWKZAKO-ZCTZIRFPSA-N |
| XLogP | -3.87 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |