C16H22N2O3 — CID 134689950
(3R,3aS,6aR)-N-benzyl-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide (PubChem CID 134689950) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3R,3aS,6aR)-N-benzyl-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide.
| Compound Name | (3R,3aS,6aR)-N-benzyl-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 134689950 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (3R,3aS,6aR)-N-benzyl-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide |
| SMILES | CCO[C@H]1CN(C(=O)NCc2ccccc2)[C@H]2COC[C@@H]12 |
| InChI | InChI=1S/C16H22N2O3/c1-2-21-15-9-18(14-11-20-10-13(14)15)16(19)17-8-12-6-4-3-5-7-12/h3-7,13-15H,2,8-11H2,1H3,(H,17,19)/t13-,14+,15+/m1/s1 |
| InChIKey | PRYWJRAXIOBWEH-ILXRZTDVSA-N |
| XLogP | 1.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |