C19H25N3O2 — CID 134690001
3-[[(3S)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile (PubChem CID 134690001) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[[(3S)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[(3S)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 134690001 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[[(3S)-3-morpholin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2C[C@H](N3CCOCC3)C3OCCCC32)c1 |
| InChI | InChI=1S/C19H25N3O2/c20-12-15-3-1-4-16(11-15)13-22-14-18(21-6-9-23-10-7-21)19-17(22)5-2-8-24-19/h1,3-4,11,17-19H,2,5-10,13-14H2/t17?,18-,19?/m0/s1 |
| InChIKey | ICWLHNQMQCMTRB-XBMUEBEBSA-N |
| XLogP | 1.62 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |