C16H24N4O3 — CID 134690112
(2S)-N-methyl-5-(5-methyl-1,2-oxazole-4-carbonyl)-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 134690112) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2S)-N-methyl-5-(5-methyl-1,2-oxazole-4-carbonyl)-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2S)-N-methyl-5-(5-methyl-1,2-oxazole-4-carbonyl)-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134690112 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2S)-N-methyl-5-(5-methyl-1,2-oxazole-4-carbonyl)-1-propan-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CC2CN(C(=O)c3cnoc3C)CC2N1C(C)C |
| InChI | InChI=1S/C16H24N4O3/c1-9(2)20-13(15(21)17-4)5-11-7-19(8-14(11)20)16(22)12-6-18-23-10(12)3/h6,9,11,13-14H,5,7-8H2,1-4H3,(H,17,21)/t11?,13-,14?/m0/s1 |
| InChIKey | BUWLKSFYKOFGJT-QRMWWUJWSA-N |
| XLogP | 0.65 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |