C19H25FN2O3 — CID 134690244
2-[(2R,3aR,6aS)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone (PubChem CID 134690244) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[(2R,3aR,6aS)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone.
| Compound Name | 2-[(2R,3aR,6aS)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone |
|---|---|
| PubChem CID | 134690244 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[(2R,3aR,6aS)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone |
| SMILES | O=C(C[C@H]1C[C@@H]2CN(Cc3ccc(F)cc3)C[C@H]2O1)N1CCCCO1 |
| InChI | InChI=1S/C19H25FN2O3/c20-16-5-3-14(4-6-16)11-21-12-15-9-17(25-18(15)13-21)10-19(23)22-7-1-2-8-24-22/h3-6,15,17-18H,1-2,7-13H2/t15-,17-,18-/m1/s1 |
| InChIKey | DMYRAMIXPFMOIQ-KBAYOESNSA-N |
| XLogP | 2.36 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |