C16H25N5O3 — CID 134690287
(2R)-N-[2-(dimethylamino)ethyl]-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide (PubChem CID 134690287) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is (2R)-N-[2-(dimethylamino)ethyl]-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide.
| Compound Name | (2R)-N-[2-(dimethylamino)ethyl]-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134690287 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (2R)-N-[2-(dimethylamino)ethyl]-4-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide |
| SMILES | COc1cc(N2CCC3O[C@@H](C(=O)NCCN(C)C)CC32)ncn1 |
| InChI | InChI=1S/C16H25N5O3/c1-20(2)7-5-17-16(22)13-8-11-12(24-13)4-6-21(11)14-9-15(23-3)19-10-18-14/h9-13H,4-8H2,1-3H3,(H,17,22)/t11?,12?,13-/m1/s1 |
| InChIKey | MRZFPFCYSSECPE-WXRRBKDZSA-N |
| XLogP | -0.10 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |