C15H22N4O4S — CID 134690332
[(1R,5R,7R)-3-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 134690332) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is [(1R,5R,7R)-3-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [(1R,5R,7R)-3-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 134690332 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [(1R,5R,7R)-3-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CC(C)CN1C[C@]23CN(C(=O)c4ccn[nH]4)C[C@@H](C[C@H]2S1(=O)=O)O3 |
| InChI | InChI=1S/C15H22N4O4S/c1-10(2)6-19-9-15-8-18(14(20)12-3-4-16-17-12)7-11(23-15)5-13(15)24(19,21)22/h3-4,10-11,13H,5-9H2,1-2H3,(H,16,17)/t11-,13-,15-/m1/s1 |
| InChIKey | KJWVKALYCVABDG-UXIGCNINSA-N |
| XLogP | 0.06 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |