C17H27N3O — CID 134690396
1-[(1S,3aS,7aS)-5-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine (PubChem CID 134690396) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[(1S,3aS,7aS)-5-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1S,3aS,7aS)-5-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 134690396 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-[(1S,3aS,7aS)-5-[(6-methyl-2-pyridinyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]-N,N-dimethylmethanamine |
| SMILES | Cc1cccc(CN2CC[C@H]3[C@H](CO[C@@H]3CN(C)C)C2)n1 |
| InChI | InChI=1S/C17H27N3O/c1-13-5-4-6-15(18-13)10-20-8-7-16-14(9-20)12-21-17(16)11-19(2)3/h4-6,14,16-17H,7-12H2,1-3H3/t14-,16-,17+/m0/s1 |
| InChIKey | NESUYBNHTHSYPB-BHYGNILZSA-N |
| XLogP | 1.79 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |