C18H27N3O3 — CID 134690471
(3R,3aS,6aR)-N-benzyl-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide (PubChem CID 134690471) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (3R,3aS,6aR)-N-benzyl-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide.
| Compound Name | (3R,3aS,6aR)-N-benzyl-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 134690471 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (3R,3aS,6aR)-N-benzyl-3-[2-(dimethylamino)ethoxy]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxamide |
| SMILES | CN(C)CCO[C@H]1CN(C(=O)NCc2ccccc2)[C@H]2COC[C@@H]12 |
| InChI | InChI=1S/C18H27N3O3/c1-20(2)8-9-24-17-11-21(16-13-23-12-15(16)17)18(22)19-10-14-6-4-3-5-7-14/h3-7,15-17H,8-13H2,1-2H3,(H,19,22)/t15-,16+,17+/m1/s1 |
| InChIKey | FANUPJSFAIYKJK-IKGGRYGDSA-N |
| XLogP | 1.17 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |