C17H25N3O2 — CID 134690561
(4R,4aR,8aR)-6-ethyl-N-(pyridin-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide (PubChem CID 134690561) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (4R,4aR,8aR)-6-ethyl-N-(pyridin-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide.
| Compound Name | (4R,4aR,8aR)-6-ethyl-N-(pyridin-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134690561 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (4R,4aR,8aR)-6-ethyl-N-(pyridin-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
| SMILES | CCN1CC[C@H]2OCC[C@@H](C(=O)NCc3cccnc3)[C@@H]2C1 |
| InChI | InChI=1S/C17H25N3O2/c1-2-20-8-5-16-15(12-20)14(6-9-22-16)17(21)19-11-13-4-3-7-18-10-13/h3-4,7,10,14-16H,2,5-6,8-9,11-12H2,1H3,(H,19,21)/t14-,15+,16-/m1/s1 |
| InChIKey | SKKKOFYVHRLZPP-OWCLPIDISA-N |
| XLogP | 1.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |