About 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate
3-phenylpropylazanium;N-(3-phenylpropyl)carbamate (PubChem CID 134690575) has the molecular formula C19H26N2O2
and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate.
Molecular Properties
| Compound Name | 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate |
| PubChem CID | 134690575 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate |
| SMILES | O=C([O-])NCCCc1ccccc1.[NH3+]CCCc1ccccc1 |
| InChI | InChI=1S/C10H13NO2.C9H13N/c12-10(13)11-8-4-7-9-5-2-1-3-6-9;10-8-4-7-9-5-2-1-3-6-9/h1-3,5-6,11H,4,7-8H2,(H,12,13);1-3,5-6H,4,7-8,10H2 |
| InChIKey | HHBWWQAPWOXPFS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate?
The IUPAC name of 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate (CID 134690575) is 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate.
What is the SMILES notation for 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate?
The canonical SMILES for 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate is O=C([O-])NCCCc1ccccc1.[NH3+]CCCc1ccccc1.
What is the InChIKey of 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate?
The InChIKey is HHBWWQAPWOXPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C9H13N/c12-10(13)11-8-4-7-9-5-2-1-3-6-9;10-8-4-7-9-5-2-1-3-6-9/h1-3,5-6,11H,4,7-8H2,(H,12,13);1-3,5-6H,4,7-8,10H2.
What are the key properties of 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate?
3-phenylpropylazanium;N-(3-phenylpropyl)carbamate has a molecular weight of 314.43 g/mol, XLogP of 1.41, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropylazanium;N-(3-phenylpropyl)carbamate is sourced from PubChem (CID 134690575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).