About methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride
methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride (PubChem CID 134690745) has the molecular formula C8H12Cl2N2O2
and a molecular weight of 239.10 g/mol. Its IUPAC name is methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride |
| PubChem CID | 134690745 |
| Molecular Formula | C8H12Cl2N2O2 |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1cc(CN)ccn1.Cl.Cl |
| InChI | InChI=1S/C8H10N2O2.2ClH/c1-12-8(11)7-4-6(5-9)2-3-10-7;;/h2-4H,5,9H2,1H3;2*1H |
| InChIKey | YRZWDEKJYNLZBH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride?
The IUPAC name of methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride (CID 134690745) is methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride.
What is the SMILES notation for methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride?
The canonical SMILES for methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride is COC(=O)c1cc(CN)ccn1.Cl.Cl.
What is the InChIKey of methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride?
The InChIKey is YRZWDEKJYNLZBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.2ClH/c1-12-8(11)7-4-6(5-9)2-3-10-7;;/h2-4H,5,9H2,1H3;2*1H.
What are the key properties of methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride?
methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride has a molecular weight of 239.10 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride is sourced from PubChem (CID 134690745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).