About lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate
lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate (PubChem CID 134690749) has the molecular formula C8H9LiN2O3
and a molecular weight of 188.11 g/mol. Its IUPAC name is lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate.
Molecular Properties
| Compound Name | lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate |
| PubChem CID | 134690749 |
| Molecular Formula | C8H9LiN2O3 |
| Molecular Weight | 188.11 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate |
| SMILES | O=C([O-])CCc1nnc(C2CC2)o1.[Li+] |
| InChI | InChI=1S/C8H10N2O3.Li/c11-7(12)4-3-6-9-10-8(13-6)5-1-2-5;/h5H,1-4H2,(H,11,12);/q;+1/p-1 |
| InChIKey | UROXAXGARMOEEJ-UHFFFAOYSA-M |
| XLogP | -3.37 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.11 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
The IUPAC name of lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate (CID 134690749) is lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate.
What is the SMILES notation for lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
The canonical SMILES for lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate is O=C([O-])CCc1nnc(C2CC2)o1.[Li+].
What is the InChIKey of lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
The InChIKey is UROXAXGARMOEEJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10N2O3.Li/c11-7(12)4-3-6-9-10-8(13-6)5-1-2-5;/h5H,1-4H2,(H,11,12);/q;+1/p-1.
What are the key properties of lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate has a molecular weight of 188.11 g/mol, XLogP of -3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate is sourced from PubChem (CID 134690749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).