About 6-ethoxypyridin-2-amine;hydrochloride
6-ethoxypyridin-2-amine;hydrochloride (PubChem CID 134690773) has the molecular formula C7H11ClN2O
and a molecular weight of 174.63 g/mol. Its IUPAC name is 6-ethoxypyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-ethoxypyridin-2-amine;hydrochloride |
| PubChem CID | 134690773 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 6-ethoxypyridin-2-amine;hydrochloride |
| SMILES | CCOc1cccc(N)n1.Cl |
| InChI | InChI=1S/C7H10N2O.ClH/c1-2-10-7-5-3-4-6(8)9-7;/h3-5H,2H2,1H3,(H2,8,9);1H |
| InChIKey | WLUGWFGWTDFUIB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethoxypyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxypyridin-2-amine;hydrochloride?
The IUPAC name of 6-ethoxypyridin-2-amine;hydrochloride (CID 134690773) is 6-ethoxypyridin-2-amine;hydrochloride.
What is the SMILES notation for 6-ethoxypyridin-2-amine;hydrochloride?
The canonical SMILES for 6-ethoxypyridin-2-amine;hydrochloride is CCOc1cccc(N)n1.Cl.
What is the InChIKey of 6-ethoxypyridin-2-amine;hydrochloride?
The InChIKey is WLUGWFGWTDFUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.ClH/c1-2-10-7-5-3-4-6(8)9-7;/h3-5H,2H2,1H3,(H2,8,9);1H.
What are the key properties of 6-ethoxypyridin-2-amine;hydrochloride?
6-ethoxypyridin-2-amine;hydrochloride has a molecular weight of 174.63 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxypyridin-2-amine;hydrochloride is sourced from PubChem (CID 134690773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).