About 2-(bromomethyl)-5,5-dimethyloxane
2-(bromomethyl)-5,5-dimethyloxane (PubChem CID 134690899) has the molecular formula C8H15BrO
and a molecular weight of 207.11 g/mol. Its IUPAC name is 2-(bromomethyl)-5,5-dimethyloxane.
Molecular Properties
| Compound Name | 2-(bromomethyl)-5,5-dimethyloxane |
| PubChem CID | 134690899 |
| Molecular Formula | C8H15BrO |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-(bromomethyl)-5,5-dimethyloxane |
| SMILES | CC1(C)CCC(CBr)OC1 |
| InChI | InChI=1S/C8H15BrO/c1-8(2)4-3-7(5-9)10-6-8/h7H,3-6H2,1-2H3 |
| InChIKey | NWWOFDDZNBWTTJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-5,5-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-5,5-dimethyloxane?
The IUPAC name of 2-(bromomethyl)-5,5-dimethyloxane (CID 134690899) is 2-(bromomethyl)-5,5-dimethyloxane.
What is the SMILES notation for 2-(bromomethyl)-5,5-dimethyloxane?
The canonical SMILES for 2-(bromomethyl)-5,5-dimethyloxane is CC1(C)CCC(CBr)OC1.
What is the InChIKey of 2-(bromomethyl)-5,5-dimethyloxane?
The InChIKey is NWWOFDDZNBWTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrO/c1-8(2)4-3-7(5-9)10-6-8/h7H,3-6H2,1-2H3.
What are the key properties of 2-(bromomethyl)-5,5-dimethyloxane?
2-(bromomethyl)-5,5-dimethyloxane has a molecular weight of 207.11 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-5,5-dimethyloxane is sourced from PubChem (CID 134690899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).