About 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride
5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride (PubChem CID 134690923) has the molecular formula C5H7Cl2NS
and a molecular weight of 184.09 g/mol. Its IUPAC name is 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride |
| PubChem CID | 134690923 |
| Molecular Formula | C5H7Cl2NS |
| Molecular Weight | 184.09 g/mol |
| Exact Mass | 182.97 |
| IUPAC Name | 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride |
| SMILES | Cc1cc(CCl)sn1.Cl |
| InChI | InChI=1S/C5H6ClNS.ClH/c1-4-2-5(3-6)8-7-4;/h2H,3H2,1H3;1H |
| InChIKey | XGMVZXMZZUNVNK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.09 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride?
The IUPAC name of 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride (CID 134690923) is 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride.
What is the SMILES notation for 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride?
The canonical SMILES for 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride is Cc1cc(CCl)sn1.Cl.
What is the InChIKey of 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride?
The InChIKey is XGMVZXMZZUNVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClNS.ClH/c1-4-2-5(3-6)8-7-4;/h2H,3H2,1H3;1H.
What are the key properties of 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride?
5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride has a molecular weight of 184.09 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-3-methyl-1,2-thiazole;hydrochloride is sourced from PubChem (CID 134690923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).