About dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride
dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride (PubChem CID 134690949) has the molecular formula C5H11Cl2N3OS
and a molecular weight of 232.14 g/mol. Its IUPAC name is dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride.
Molecular Properties
| Compound Name | dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride |
| PubChem CID | 134690949 |
| Molecular Formula | C5H11Cl2N3OS |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride |
| SMILES | CS(C)(=O)=Nc1cn[nH]c1.Cl.Cl |
| InChI | InChI=1S/C5H9N3OS.2ClH/c1-10(2,9)8-5-3-6-7-4-5;;/h3-4H,1-2H3,(H,6,7);2*1H |
| InChIKey | IQVMWARNPZLVKA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride?
The IUPAC name of dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride (CID 134690949) is dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride.
What is the SMILES notation for dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride?
The canonical SMILES for dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride is CS(C)(=O)=Nc1cn[nH]c1.Cl.Cl.
What is the InChIKey of dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride?
The InChIKey is IQVMWARNPZLVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3OS.2ClH/c1-10(2,9)8-5-3-6-7-4-5;;/h3-4H,1-2H3,(H,6,7);2*1H.
What are the key properties of dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride?
dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride has a molecular weight of 232.14 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-oxo-(1H-pyrazol-4-ylimino)-λ6-sulfane;dihydrochloride is sourced from PubChem (CID 134690949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).