About N,N-diethyl-2-iodoethanamine;hydroiodide
N,N-diethyl-2-iodoethanamine;hydroiodide (PubChem CID 134691049) has the molecular formula C6H15I2N
and a molecular weight of 355.00 g/mol. Its IUPAC name is N,N-diethyl-2-iodoethanamine;hydroiodide.
Molecular Properties
| Compound Name | N,N-diethyl-2-iodoethanamine;hydroiodide |
| PubChem CID | 134691049 |
| Molecular Formula | C6H15I2N |
| Molecular Weight | 355.00 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | N,N-diethyl-2-iodoethanamine;hydroiodide |
| SMILES | CCN(CC)CCI.I |
| InChI | InChI=1S/C6H14IN.HI/c1-3-8(4-2)6-5-7;/h3-6H2,1-2H3;1H |
| InChIKey | PYJIENIOICTQIP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.00 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-2-iodoethanamine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-iodoethanamine;hydroiodide?
The IUPAC name of N,N-diethyl-2-iodoethanamine;hydroiodide (CID 134691049) is N,N-diethyl-2-iodoethanamine;hydroiodide.
What is the SMILES notation for N,N-diethyl-2-iodoethanamine;hydroiodide?
The canonical SMILES for N,N-diethyl-2-iodoethanamine;hydroiodide is CCN(CC)CCI.I.
What is the InChIKey of N,N-diethyl-2-iodoethanamine;hydroiodide?
The InChIKey is PYJIENIOICTQIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14IN.HI/c1-3-8(4-2)6-5-7;/h3-6H2,1-2H3;1H.
What are the key properties of N,N-diethyl-2-iodoethanamine;hydroiodide?
N,N-diethyl-2-iodoethanamine;hydroiodide has a molecular weight of 355.00 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-iodoethanamine;hydroiodide is sourced from PubChem (CID 134691049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).