About 1,2,2-trimethylpiperidin-4-one;hydrochloride
1,2,2-trimethylpiperidin-4-one;hydrochloride (PubChem CID 134691087) has the molecular formula C8H16ClNO
and a molecular weight of 177.68 g/mol. Its IUPAC name is 1,2,2-trimethylpiperidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 1,2,2-trimethylpiperidin-4-one;hydrochloride |
| PubChem CID | 134691087 |
| Molecular Formula | C8H16ClNO |
| Molecular Weight | 177.68 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 1,2,2-trimethylpiperidin-4-one;hydrochloride |
| SMILES | CN1CCC(=O)CC1(C)C.Cl |
| InChI | InChI=1S/C8H15NO.ClH/c1-8(2)6-7(10)4-5-9(8)3;/h4-6H2,1-3H3;1H |
| InChIKey | FJYOOMRORXYLBO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.68 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,2-trimethylpiperidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trimethylpiperidin-4-one;hydrochloride?
The IUPAC name of 1,2,2-trimethylpiperidin-4-one;hydrochloride (CID 134691087) is 1,2,2-trimethylpiperidin-4-one;hydrochloride.
What is the SMILES notation for 1,2,2-trimethylpiperidin-4-one;hydrochloride?
The canonical SMILES for 1,2,2-trimethylpiperidin-4-one;hydrochloride is CN1CCC(=O)CC1(C)C.Cl.
What is the InChIKey of 1,2,2-trimethylpiperidin-4-one;hydrochloride?
The InChIKey is FJYOOMRORXYLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.ClH/c1-8(2)6-7(10)4-5-9(8)3;/h4-6H2,1-3H3;1H.
What are the key properties of 1,2,2-trimethylpiperidin-4-one;hydrochloride?
1,2,2-trimethylpiperidin-4-one;hydrochloride has a molecular weight of 177.68 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trimethylpiperidin-4-one;hydrochloride is sourced from PubChem (CID 134691087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).