C11H17ClN2 — CID 134691155
2,2,4-trimethyl-1,3-dihydroquinoxaline;hydrochloride (PubChem CID 134691155) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 2,2,4-trimethyl-1,3-dihydroquinoxaline;hydrochloride.
| Compound Name | 2,2,4-trimethyl-1,3-dihydroquinoxaline;hydrochloride |
|---|---|
| PubChem CID | 134691155 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2,2,4-trimethyl-1,3-dihydroquinoxaline;hydrochloride |
| SMILES | CN1CC(C)(C)Nc2ccccc21.Cl |
| InChI | InChI=1S/C11H16N2.ClH/c1-11(2)8-13(3)10-7-5-4-6-9(10)12-11;/h4-7,12H,8H2,1-3H3;1H |
| InChIKey | GQJANNRLRAFIFX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |