C30H31N3O4 — CID 134691283
3-[(9R)-6-ethoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 134691283) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-[(9R)-6-ethoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | 3-[(9R)-6-ethoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 134691283 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 3-[(9R)-6-ethoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N-[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | CCOc1cccc2c1O[C@]1(C)CC2NC(=O)N1c1cccc(C(=O)N[C@@H]2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C30H31N3O4/c1-3-36-26-13-7-12-24-25-18-30(2,37-27(24)26)33(29(35)32-25)23-11-6-10-21(17-23)28(34)31-22-15-14-19-8-4-5-9-20(19)16-22/h4-13,17,22,25H,3,14-16,18H2,1-2H3,(H,31,34)(H,32,35)/t22-,25?,30-/m1/s1 |
| InChIKey | SUWICMHEJQWBNP-MZAYKIAMSA-N |
| XLogP | 5.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |