About calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate
calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate (PubChem CID 134691335) has the molecular formula C4CaO9
and a molecular weight of 232.11 g/mol. Its IUPAC name is calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate.
Molecular Properties
| Compound Name | calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate |
| PubChem CID | 134691335 |
| Molecular Formula | C4CaO9 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.92 |
| IUPAC Name | calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate |
| SMILES | O=C([O-])OC1(OC(=O)[O-])OC(=O)O1.[Ca+2] |
| InChI | InChI=1S/C4H2O9.Ca/c5-1(6)10-4(11-2(7)8)12-3(9)13-4;/h(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | KEDACJNTXYKNFY-UHFFFAOYSA-L |
| XLogP | -2.90 |
| TPSA | 134.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate?
The IUPAC name of calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate (CID 134691335) is calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate.
What is the SMILES notation for calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate?
The canonical SMILES for calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate is O=C([O-])OC1(OC(=O)[O-])OC(=O)O1.[Ca+2].
What is the InChIKey of calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate?
The InChIKey is KEDACJNTXYKNFY-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H2O9.Ca/c5-1(6)10-4(11-2(7)8)12-3(9)13-4;/h(H,5,6)(H,7,8);/q;+2/p-2.
What are the key properties of calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate?
calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate has a molecular weight of 232.11 g/mol, XLogP of -2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for calcium (2-carboxylatooxy-4-oxo-1,3-dioxetan-2-yl) carbonate is sourced from PubChem (CID 134691335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).