C27H25NO9 — CID 134691639
[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-2,3-dihydrochromen-7-yl] (2S)-2-benzamido-3-methylbutanoate (PubChem CID 134691639) has the molecular formula C27H25NO9 and a molecular weight of 507.50 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-2,3-dihydrochromen-7-yl] (2S)-2-benzamido-3-methylbutanoate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-2,3-dihydrochromen-7-yl] (2S)-2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 134691639 |
| Molecular Formula | C27H25NO9 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-2,3-dihydrochromen-7-yl] (2S)-2-benzamido-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1)C(=O)Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2=O |
| InChI | InChI=1S/C27H25NO9/c1-13(2)22(28-26(34)14-6-4-3-5-7-14)27(35)36-16-11-19(31)21-20(12-16)37-25(24(33)23(21)32)15-8-9-17(29)18(30)10-15/h3-13,22,24-25,29-31,33H,1-2H3,(H,28,34)/t22-,24?,25?/m0/s1 |
| InChIKey | ZQSFRBQZCRAPLQ-BSSNWTCHSA-N |
| XLogP | 2.84 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|