About 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride
2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride (PubChem CID 134692018) has the molecular formula C7H11ClF3NO
and a molecular weight of 217.62 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride |
| PubChem CID | 134692018 |
| Molecular Formula | C7H11ClF3NO |
| Molecular Weight | 217.62 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCNC1)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO.ClH/c8-7(9,10)6(12)5-2-1-3-11-4-5;/h5,11H,1-4H2;1H |
| InChIKey | PTNJEWMAZSBHFO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.62 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride?
The IUPAC name of 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride (CID 134692018) is 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride.
What is the SMILES notation for 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride?
The canonical SMILES for 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride is Cl.O=C(C1CCCNC1)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride?
The InChIKey is PTNJEWMAZSBHFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3NO.ClH/c8-7(9,10)6(12)5-2-1-3-11-4-5;/h5,11H,1-4H2;1H.
What are the key properties of 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride?
2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride has a molecular weight of 217.62 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-1-piperidin-3-ylethanone;hydrochloride is sourced from PubChem (CID 134692018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).