C26H27NO10 — CID 134692768
(9S)-9-acetyl-7-[(2R,4S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,6,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 134692768) has the molecular formula C26H27NO10 and a molecular weight of 513.50 g/mol. Its IUPAC name is (9S)-9-acetyl-7-[(2R,4S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,6,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (9S)-9-acetyl-7-[(2R,4S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,6,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 134692768 |
| Molecular Formula | C26H27NO10 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | (9S)-9-acetyl-7-[(2R,4S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-4,6,9,11-tetrahydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2C(O[C@H]2C[C@H](N)C(O)[C@H](C)O2)C1)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C26H27NO10/c1-9-21(30)13(27)6-16(36-9)37-15-8-26(35,10(2)28)7-12-18(15)25(34)20-19(23(12)32)22(31)11-4-3-5-14(29)17(11)24(20)33/h3-5,9,13,15-16,21,29-30,32,34-35H,6-8,27H2,1-2H3/t9-,13-,15?,16-,21?,26-/m0/s1 |
| InChIKey | XREUEWVEMYWFFA-MJOJEFOKSA-N |
| XLogP | 0.73 |
| TPSA | 196.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|