C24H34BNO2S — CID 134693522
4-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[3,2-b]indole (PubChem CID 134693522) has the molecular formula C24H34BNO2S and a molecular weight of 411.42 g/mol. Its IUPAC name is 4-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[3,2-b]indole.
| Compound Name | 4-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[3,2-b]indole |
|---|---|
| PubChem CID | 134693522 |
| Molecular Formula | C24H34BNO2S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[3,2-b]indole |
| SMILES | CCCCCCCCn1c2cc(B3OC(C)(C)C(C)(C)O3)ccc2c2sccc21 |
| InChI | InChI=1S/C24H34BNO2S/c1-6-7-8-9-10-11-15-26-20-14-16-29-22(20)19-13-12-18(17-21(19)26)25-27-23(2,3)24(4,5)28-25/h12-14,16-17H,6-11,15H2,1-5H3 |
| InChIKey | MMYCVHGEIHXNOA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|