About 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione
6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 134693782) has the molecular formula C13H10N2O3S
and a molecular weight of 274.30 g/mol. Its IUPAC name is 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| PubChem CID | 134693782 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2sc(Cc3ccccc3)cc2c(=O)n1O |
| InChI | InChI=1S/C13H10N2O3S/c16-12-10-7-9(6-8-4-2-1-3-5-8)19-11(10)14-13(17)15(12)18/h1-5,7,18H,6H2,(H,14,17) |
| InChIKey | BATRIMGMBZXTOT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione?
The IUPAC name of 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione (CID 134693782) is 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione.
What is the SMILES notation for 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione?
The canonical SMILES for 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione is O=c1[nH]c2sc(Cc3ccccc3)cc2c(=O)n1O.
What is the InChIKey of 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione?
The InChIKey is BATRIMGMBZXTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3S/c16-12-10-7-9(6-8-4-2-1-3-5-8)19-11(10)14-13(17)15(12)18/h1-5,7,18H,6H2,(H,14,17).
What are the key properties of 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione?
6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione has a molecular weight of 274.30 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione is sourced from PubChem (CID 134693782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).