C36H56O3S — CID 134694077
[(3S,4S,5S,10S,13R,14R,17R)-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate (PubChem CID 134694077) has the molecular formula C36H56O3S and a molecular weight of 568.91 g/mol. Its IUPAC name is [(3S,4S,5S,10S,13R,14R,17R)-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4S,5S,10S,13R,14R,17R)-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134694077 |
| Molecular Formula | C36H56O3S |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 568.40 |
| IUPAC Name | [(3S,4S,5S,10S,13R,14R,17R)-4,10,13,14-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC[C@]3(C)C4=C(CC[C@H]3[C@@H]2C)[C@]2(C)CC[C@H]([C@H](C)CCCC(C)C)[C@@]2(C)CC4)cc1 |
| InChI | InChI=1S/C36H56O3S/c1-24(2)10-9-11-26(4)29-18-22-36(8)32-17-16-30-27(5)33(39-40(37,38)28-14-12-25(3)13-15-28)20-21-34(30,6)31(32)19-23-35(29,36)7/h12-15,24,26-27,29-30,33H,9-11,16-23H2,1-8H3/t26-,27+,29-,30+,33+,34+,35-,36+/m1/s1 |
| InChIKey | QCUGDTHPBKWHKK-YFDOIQLHSA-N |
| XLogP | 9.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|