C8H7F11N2O2 — CID 134694480
N-(2-aminoethyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide (PubChem CID 134694480) has the molecular formula C8H7F11N2O2 and a molecular weight of 372.13 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide.
| Compound Name | N-(2-aminoethyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 134694480 |
| Molecular Formula | C8H7F11N2O2 |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-(2-aminoethyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
| SMILES | NCCNC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7F11N2O2/c9-4(6(12,13)14,3(22)21-2-1-20)23-8(18,19)5(10,11)7(15,16)17/h1-2,20H2,(H,21,22) |
| InChIKey | QWKLSZPKPIMKSW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|