C10H8F11NO2 — CID 134694488
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methyl-N-prop-2-enylpropanamide (PubChem CID 134694488) has the molecular formula C10H8F11NO2 and a molecular weight of 383.16 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methyl-N-prop-2-enylpropanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 134694488 |
| Molecular Formula | C10H8F11NO2 |
| Molecular Weight | 383.16 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C)C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F11NO2/c1-3-4-22(2)5(23)6(11,8(14,15)16)24-10(20,21)7(12,13)9(17,18)19/h3H,1,4H2,2H3 |
| InChIKey | KNGNTRNWDBFFRW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|