C13H10F17NO5 — CID 134694592
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-bis(2-hydroxyethyl)propanamide (PubChem CID 134694592) has the molecular formula C13H10F17NO5 and a molecular weight of 583.19 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-bis(2-hydroxyethyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-bis(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 134694592 |
| Molecular Formula | C13H10F17NO5 |
| Molecular Weight | 583.19 g/mol |
| Exact Mass | 583.03 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-bis(2-hydroxyethyl)propanamide |
| SMILES | O=C(N(CCO)CCO)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H10F17NO5/c14-6(9(18,19)20,5(34)31(1-3-32)2-4-33)35-13(29,30)8(17,11(24,25)26)36-12(27,28)7(15,16)10(21,22)23/h32-33H,1-4H2 |
| InChIKey | BDTZBAUVODUZNE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|