C17H24N2O4 — CID 134695136
(2R,10R,12S)-2-(2-hydroxyethyl)-5,7,13,13-tetramethyl-3-oxa-5,7-diazatetracyclo[10.1.1.02,10.04,9]tetradec-4(9)-ene-6,8-dione (PubChem CID 134695136) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R,10R,12S)-2-(2-hydroxyethyl)-5,7,13,13-tetramethyl-3-oxa-5,7-diazatetracyclo[10.1.1.02,10.04,9]tetradec-4(9)-ene-6,8-dione.
| Compound Name | (2R,10R,12S)-2-(2-hydroxyethyl)-5,7,13,13-tetramethyl-3-oxa-5,7-diazatetracyclo[10.1.1.02,10.04,9]tetradec-4(9)-ene-6,8-dione |
|---|---|
| PubChem CID | 134695136 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2R,10R,12S)-2-(2-hydroxyethyl)-5,7,13,13-tetramethyl-3-oxa-5,7-diazatetracyclo[10.1.1.02,10.04,9]tetradec-4(9)-ene-6,8-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@H]1C[C@@H]3CC(C3(C)C)[C@@]1(CCO)O2 |
| InChI | InChI=1S/C17H24N2O4/c1-16(2)9-7-10-12-13(21)18(3)15(22)19(4)14(12)23-17(10,5-6-20)11(16)8-9/h9-11,20H,5-8H2,1-4H3/t9-,10-,11?,17+/m1/s1 |
| InChIKey | CSCXDGNLHJHCJB-XGRPIWJWSA-N |
| XLogP | 0.75 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |