About methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate
methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate (PubChem CID 134695150) has the molecular formula C17H22N2O4S
and a molecular weight of 350.44 g/mol. Its IUPAC name is methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate |
| PubChem CID | 134695150 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate |
| SMILES | COC(=O)C1=C(N)C2(CCCCC2)N(Cc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C17H22N2O4S/c1-23-16(20)14-15(18)17(10-6-3-7-11-17)19(24(14,21)22)12-13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-12,18H2,1H3 |
| InChIKey | CYXAWPJUQXZEFX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate?
The IUPAC name of methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate (CID 134695150) is methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate.
What is the SMILES notation for methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate?
The canonical SMILES for methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate is COC(=O)C1=C(N)C2(CCCCC2)N(Cc2ccccc2)S1(=O)=O.
What is the InChIKey of methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate?
The InChIKey is CYXAWPJUQXZEFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4S/c1-23-16(20)14-15(18)17(10-6-3-7-11-17)19(24(14,21)22)12-13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-12,18H2,1H3.
What are the key properties of methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate?
methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate has a molecular weight of 350.44 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-1-benzyl-2,2-dioxo-2λ6-thia-1-azaspiro[4.5]dec-3-ene-3-carboxylate is sourced from PubChem (CID 134695150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).