C22H44O3Si — CID 134695181
(Z,12R)-12-hydroxy-2-methyl-2-trimethylsilyloctadec-9-enoic acid (PubChem CID 134695181) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is (Z,12R)-12-hydroxy-2-methyl-2-trimethylsilyloctadec-9-enoic acid.
| Compound Name | (Z,12R)-12-hydroxy-2-methyl-2-trimethylsilyloctadec-9-enoic acid |
|---|---|
| PubChem CID | 134695181 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | (Z,12R)-12-hydroxy-2-methyl-2-trimethylsilyloctadec-9-enoic acid |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCC(C)(C(=O)O)[Si](C)(C)C |
| InChI | InChI=1S/C22H44O3Si/c1-6-7-8-14-17-20(23)18-15-12-10-9-11-13-16-19-22(2,21(24)25)26(3,4)5/h12,15,20,23H,6-11,13-14,16-19H2,1-5H3,(H,24,25)/b15-12-/t20-,22?/m1/s1 |
| InChIKey | VSZFHBKAPDKRRW-GEMGIMPASA-N |
| XLogP | 6.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|