C16H24N2O2 — CID 134695556
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylfuran-3-carboxamide (PubChem CID 134695556) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylfuran-3-carboxamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 134695556 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylfuran-3-carboxamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)c3ccoc3)C[C@@H]2C1 |
| InChI | InChI=1S/C16H24N2O2/c1-17(2)14-6-12-8-15(9-13(12)7-14)18(3)16(19)11-4-5-20-10-11/h4-5,10,12-15H,6-9H2,1-3H3/t12-,13+,14?,15? |
| InChIKey | GPBLXOIMIXTMFM-DGKWVBSXSA-N |
| XLogP | 2.47 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |