C20H26N4O — CID 134696118
N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylquinoxaline-2-carboxamide (PubChem CID 134696118) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylquinoxaline-2-carboxamide.
| Compound Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 134696118 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methylquinoxaline-2-carboxamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)c3cnc4ccccc4n3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H26N4O/c1-23(2)15-8-13-10-16(11-14(13)9-15)24(3)20(25)19-12-21-17-6-4-5-7-18(17)22-19/h4-7,12-16H,8-11H2,1-3H3/t13-,14+,15?,16? |
| InChIKey | ULKCQLHFVCCSTI-PJPHBNEVSA-N |
| XLogP | 2.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |