C21H31N3O3 — CID 134697254
(2S,3R)-N-butyl-N-cycloheptyl-5-oxo-3-pyridin-3-ylmorpholine-2-carboxamide (PubChem CID 134697254) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is (2S,3R)-N-butyl-N-cycloheptyl-5-oxo-3-pyridin-3-ylmorpholine-2-carboxamide.
| Compound Name | (2S,3R)-N-butyl-N-cycloheptyl-5-oxo-3-pyridin-3-ylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 134697254 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (2S,3R)-N-butyl-N-cycloheptyl-5-oxo-3-pyridin-3-ylmorpholine-2-carboxamide |
| SMILES | CCCCN(C(=O)[C@H]1OCC(=O)N[C@@H]1c1cccnc1)C1CCCCCC1 |
| InChI | InChI=1S/C21H31N3O3/c1-2-3-13-24(17-10-6-4-5-7-11-17)21(26)20-19(23-18(25)15-27-20)16-9-8-12-22-14-16/h8-9,12,14,17,19-20H,2-7,10-11,13,15H2,1H3,(H,23,25)/t19-,20+/m1/s1 |
| InChIKey | JAOMMRQMQFQLOR-UXHICEINSA-N |
| XLogP | 2.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |