C21H28N2O3 — CID 134697771
1-[(3R,4R)-3-methoxy-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-yl]-5-phenylpentan-1-one (PubChem CID 134697771) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[(3R,4R)-3-methoxy-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[(3R,4R)-3-methoxy-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 134697771 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-[(3R,4R)-3-methoxy-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-yl]-5-phenylpentan-1-one |
| SMILES | CO[C@H]1CN(C(=O)CCCCc2ccccc2)C[C@H]1Cc1cc(C)no1 |
| InChI | InChI=1S/C21H28N2O3/c1-16-12-19(26-22-16)13-18-14-23(15-20(18)25-2)21(24)11-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,12,18,20H,6-7,10-11,13-15H2,1-2H3/t18-,20+/m1/s1 |
| InChIKey | ZPDPWTOCBKZTTC-QUCCMNQESA-N |
| XLogP | 3.41 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|