C14H18N4O — CID 134698233
[3-[[[4-(ethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methanol (PubChem CID 134698233) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is [3-[[[4-(ethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methanol.
| Compound Name | [3-[[[4-(ethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 134698233 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [3-[[[4-(ethylamino)pyrimidin-2-yl]amino]methyl]phenyl]methanol |
| SMILES | CCNc1ccnc(NCc2cccc(CO)c2)n1 |
| InChI | InChI=1S/C14H18N4O/c1-2-15-13-6-7-16-14(18-13)17-9-11-4-3-5-12(8-11)10-19/h3-8,19H,2,9-10H2,1H3,(H2,15,16,17,18) |
| InChIKey | FXTAGGOAMHAESF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |